C24H19Cl2N3O2 — CID 58961579
N-[2-[[6-(2-chlorophenyl)-5-(4-chlorophenyl)-3-cyano-2-pyridinyl]oxy]ethyl]cyclopropanecarboxamide (PubChem CID 58961579) has the molecular formula C24H19Cl2N3O2 and a molecular weight of 452.34 g/mol. Its IUPAC name is N-[2-[[6-(2-chlorophenyl)-5-(4-chlorophenyl)-3-cyano-2-pyridinyl]oxy]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[6-(2-chlorophenyl)-5-(4-chlorophenyl)-3-cyano-2-pyridinyl]oxy]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 58961579 |
| Molecular Formula | C24H19Cl2N3O2 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | N-[2-[[6-(2-chlorophenyl)-5-(4-chlorophenyl)-3-cyano-2-pyridinyl]oxy]ethyl]cyclopropanecarboxamide |
| SMILES | N#Cc1cc(-c2ccc(Cl)cc2)c(-c2ccccc2Cl)nc1OCCNC(=O)C1CC1 |
| InChI | InChI=1S/C24H19Cl2N3O2/c25-18-9-7-15(8-10-18)20-13-17(14-27)24(31-12-11-28-23(30)16-5-6-16)29-22(20)19-3-1-2-4-21(19)26/h1-4,7-10,13,16H,5-6,11-12H2,(H,28,30) |
| InChIKey | QXAHQDXOJJGMTF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|