C26H26ClN5O3S — CID 10152628
methyl 2-[[5-chloro-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamothioyl)hydrazinyl]pyridine-3-carbonyl]-methylamino]acetate (PubChem CID 10152628) has the molecular formula C26H26ClN5O3S and a molecular weight of 524.05 g/mol. Its IUPAC name is methyl 2-[[5-chloro-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamothioyl)hydrazinyl]pyridine-3-carbonyl]-methylamino]acetate.
| Compound Name | methyl 2-[[5-chloro-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamothioyl)hydrazinyl]pyridine-3-carbonyl]-methylamino]acetate |
|---|---|
| PubChem CID | 10152628 |
| Molecular Formula | C26H26ClN5O3S |
| Molecular Weight | 524.05 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | methyl 2-[[5-chloro-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamothioyl)hydrazinyl]pyridine-3-carbonyl]-methylamino]acetate |
| SMILES | COC(=O)CN(C)C(=O)c1cnc(NNC(=S)NC2c3ccccc3CCc3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C26H26ClN5O3S/c1-32(15-22(33)35-2)25(34)18-13-21(27)24(28-14-18)30-31-26(36)29-23-19-9-5-3-7-16(19)11-12-17-8-4-6-10-20(17)23/h3-10,13-14,23H,11-12,15H2,1-2H3,(H,28,30)(H2,29,31,36) |
| InChIKey | QMJSYSVARUNNKE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.05 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|