C27H27ClFN7O2S — CID 10312045
5-chloro-6-[[(12-fluoro-5-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)carbamothioylamino]-methylamino]-N-[(3R)-1-methyl-2-oxopyrrolidin-3-yl]pyridine-3-carboxamide (PubChem CID 10312045) has the molecular formula C27H27ClFN7O2S and a molecular weight of 568.08 g/mol. Its IUPAC name is 5-chloro-6-[[(12-fluoro-5-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)carbamothioylamino]-methylamino]-N-[(3R)-1-methyl-2-oxopyrrolidin-3-yl]pyridine-3-carboxamide.
| Compound Name | 5-chloro-6-[[(12-fluoro-5-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)carbamothioylamino]-methylamino]-N-[(3R)-1-methyl-2-oxopyrrolidin-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10312045 |
| Molecular Formula | C27H27ClFN7O2S |
| Molecular Weight | 568.08 g/mol |
| Exact Mass | 567.16 |
| IUPAC Name | 5-chloro-6-[[(12-fluoro-5-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)carbamothioylamino]-methylamino]-N-[(3R)-1-methyl-2-oxopyrrolidin-3-yl]pyridine-3-carboxamide |
| SMILES | CN1CC[C@@H](NC(=O)c2cnc(N(C)NC(=S)NC3c4cnccc4CCc4c(F)cccc43)c(Cl)c2)C1=O |
| InChI | InChI=1S/C27H27ClFN7O2S/c1-35-11-9-22(26(35)38)32-25(37)16-12-20(28)24(31-13-16)36(2)34-27(39)33-23-18-4-3-5-21(29)17(18)7-6-15-8-10-30-14-19(15)23/h3-5,8,10,12-14,22-23H,6-7,9,11H2,1-2H3,(H,32,37)(H2,33,34,39)/t22-,23?/m1/s1 |
| InChIKey | RNLWURGFQNFHGY-WTQRLHSKSA-N |
| XLogP | 2.93 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.08 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|