C31H37ClN6OS — CID 10153120
5-chloro-N-[3-(2-methylpiperidin-1-yl)propyl]-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamothioyl)hydrazinyl]pyridine-3-carboxamide (PubChem CID 10153120) has the molecular formula C31H37ClN6OS and a molecular weight of 577.20 g/mol. Its IUPAC name is 5-chloro-N-[3-(2-methylpiperidin-1-yl)propyl]-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamothioyl)hydrazinyl]pyridine-3-carboxamide.
| Compound Name | 5-chloro-N-[3-(2-methylpiperidin-1-yl)propyl]-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamothioyl)hydrazinyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10153120 |
| Molecular Formula | C31H37ClN6OS |
| Molecular Weight | 577.20 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | 5-chloro-N-[3-(2-methylpiperidin-1-yl)propyl]-6-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamothioyl)hydrazinyl]pyridine-3-carboxamide |
| SMILES | CC1CCCCN1CCCNC(=O)c1cnc(NNC(=S)NC2c3ccccc3CCc3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C31H37ClN6OS/c1-21-9-6-7-17-38(21)18-8-16-33-30(39)24-19-27(32)29(34-20-24)36-37-31(40)35-28-25-12-4-2-10-22(25)14-15-23-11-3-5-13-26(23)28/h2-5,10-13,19-21,28H,6-9,14-18H2,1H3,(H,33,39)(H,34,36)(H2,35,37,40) |
| InChIKey | DEUHNGVQLODRJU-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.20 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|