C20H26N2O3S — CID 10156282
propyl 5-tert-butyl-3-[(4-methylphenyl)carbamoylamino]thiophene-2-carboxylate (PubChem CID 10156282) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is propyl 5-tert-butyl-3-[(4-methylphenyl)carbamoylamino]thiophene-2-carboxylate.
| Compound Name | propyl 5-tert-butyl-3-[(4-methylphenyl)carbamoylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 10156282 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | propyl 5-tert-butyl-3-[(4-methylphenyl)carbamoylamino]thiophene-2-carboxylate |
| SMILES | CCCOC(=O)c1sc(C(C)(C)C)cc1NC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C20H26N2O3S/c1-6-11-25-18(23)17-15(12-16(26-17)20(3,4)5)22-19(24)21-14-9-7-13(2)8-10-14/h7-10,12H,6,11H2,1-5H3,(H2,21,22,24) |
| InChIKey | ALLARHNKZGMVPC-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |