C15H20N4O3S — CID 21258337
5-tert-butyl-3-[(1-ethylpyrazol-3-yl)carbamoylamino]thiophene-2-carboxylic acid (PubChem CID 21258337) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is 5-tert-butyl-3-[(1-ethylpyrazol-3-yl)carbamoylamino]thiophene-2-carboxylic acid.
| Compound Name | 5-tert-butyl-3-[(1-ethylpyrazol-3-yl)carbamoylamino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 21258337 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 5-tert-butyl-3-[(1-ethylpyrazol-3-yl)carbamoylamino]thiophene-2-carboxylic acid |
| SMILES | CCn1ccc(NC(=O)Nc2cc(C(C)(C)C)sc2C(=O)O)n1 |
| InChI | InChI=1S/C15H20N4O3S/c1-5-19-7-6-11(18-19)17-14(22)16-9-8-10(15(2,3)4)23-12(9)13(20)21/h6-8H,5H2,1-4H3,(H,20,21)(H2,16,17,18,22) |
| InChIKey | GOAUXKRXGJBPQX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |