C22H16O6 — CID 10156359
(2Z)-6,7-dihydroxy-2-[(2-hydroxy-4-phenylmethoxyphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 10156359) has the molecular formula C22H16O6 and a molecular weight of 376.36 g/mol. Its IUPAC name is (2Z)-6,7-dihydroxy-2-[(2-hydroxy-4-phenylmethoxyphenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | (2Z)-6,7-dihydroxy-2-[(2-hydroxy-4-phenylmethoxyphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 10156359 |
| Molecular Formula | C22H16O6 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | (2Z)-6,7-dihydroxy-2-[(2-hydroxy-4-phenylmethoxyphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | O=C1/C(=C/c2ccc(OCc3ccccc3)cc2O)Oc2c1ccc(O)c2O |
| InChI | InChI=1S/C22H16O6/c23-17-9-8-16-20(25)19(28-22(16)21(17)26)10-14-6-7-15(11-18(14)24)27-12-13-4-2-1-3-5-13/h1-11,23-24,26H,12H2/b19-10- |
| InChIKey | XWBKQULRNBWJKE-GRSHGNNSSA-N |
| XLogP | 4.00 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|