C23H16O4 — CID 173225613
(2E)-2-(3,3-diphenylprop-2-enylidene)-6,7-dihydroxy-1-benzofuran-3-one (PubChem CID 173225613) has the molecular formula C23H16O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is (2E)-2-(3,3-diphenylprop-2-enylidene)-6,7-dihydroxy-1-benzofuran-3-one.
| Compound Name | (2E)-2-(3,3-diphenylprop-2-enylidene)-6,7-dihydroxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 173225613 |
| Molecular Formula | C23H16O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | (2E)-2-(3,3-diphenylprop-2-enylidene)-6,7-dihydroxy-1-benzofuran-3-one |
| SMILES | O=C1/C(=C\C=C(c2ccccc2)c2ccccc2)Oc2c1ccc(O)c2O |
| InChI | InChI=1S/C23H16O4/c24-19-13-11-18-21(25)20(27-23(18)22(19)26)14-12-17(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14,24,26H/b20-14+ |
| InChIKey | GPWRBCVBLRLMKG-XSFVSMFZSA-N |
| XLogP | 4.69 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|