C20H20O4 — CID 85059297
6,7-dihydroxy-2-[(2,3,4,5,6-pentamethylphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 85059297) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is 6,7-dihydroxy-2-[(2,3,4,5,6-pentamethylphenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | 6,7-dihydroxy-2-[(2,3,4,5,6-pentamethylphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 85059297 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 6,7-dihydroxy-2-[(2,3,4,5,6-pentamethylphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | Cc1c(C)c(C)c(C=C2Oc3c(ccc(O)c3O)C2=O)c(C)c1C |
| InChI | InChI=1S/C20H20O4/c1-9-10(2)12(4)15(13(5)11(9)3)8-17-18(22)14-6-7-16(21)19(23)20(14)24-17/h6-8,21,23H,1-5H3 |
| InChIKey | VGRCZKWUUVWMOI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|