C16H12O7 — CID 91280525
2-[5-[(6,7-dihydroxy-3-oxo-1-benzofuran-2-ylidene)methyl]furan-2-yl]propanoic acid (PubChem CID 91280525) has the molecular formula C16H12O7 and a molecular weight of 316.27 g/mol. Its IUPAC name is 2-[5-[(6,7-dihydroxy-3-oxo-1-benzofuran-2-ylidene)methyl]furan-2-yl]propanoic acid.
| Compound Name | 2-[5-[(6,7-dihydroxy-3-oxo-1-benzofuran-2-ylidene)methyl]furan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 91280525 |
| Molecular Formula | C16H12O7 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-[5-[(6,7-dihydroxy-3-oxo-1-benzofuran-2-ylidene)methyl]furan-2-yl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(C=C2Oc3c(ccc(O)c3O)C2=O)o1 |
| InChI | InChI=1S/C16H12O7/c1-7(16(20)21)11-5-2-8(22-11)6-12-13(18)9-3-4-10(17)14(19)15(9)23-12/h2-7,17,19H,1H3,(H,20,21) |
| InChIKey | GBGRJVRQWJNJRE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|