C21H28N6O2 — CID 10157597
7-benzyl-1,3-dimethyl-8-(3-propan-2-ylpiperazin-1-yl)purine-2,6-dione (PubChem CID 10157597) has the molecular formula C21H28N6O2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 7-benzyl-1,3-dimethyl-8-(3-propan-2-ylpiperazin-1-yl)purine-2,6-dione.
| Compound Name | 7-benzyl-1,3-dimethyl-8-(3-propan-2-ylpiperazin-1-yl)purine-2,6-dione |
|---|---|
| PubChem CID | 10157597 |
| Molecular Formula | C21H28N6O2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 7-benzyl-1,3-dimethyl-8-(3-propan-2-ylpiperazin-1-yl)purine-2,6-dione |
| SMILES | CC(C)C1CN(c2nc3c(c(=O)n(C)c(=O)n3C)n2Cc2ccccc2)CCN1 |
| InChI | InChI=1S/C21H28N6O2/c1-14(2)16-13-26(11-10-22-16)20-23-18-17(19(28)25(4)21(29)24(18)3)27(20)12-15-8-6-5-7-9-15/h5-9,14,16,22H,10-13H2,1-4H3 |
| InChIKey | RRGCXOMYSQPOSN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 77.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |