C25H28N6O2 — CID 58890734
7-benzyl-8-[(3S)-3-benzylpiperazin-1-yl]-1,3-dimethylpurine-2,6-dione (PubChem CID 58890734) has the molecular formula C25H28N6O2 and a molecular weight of 444.54 g/mol. Its IUPAC name is 7-benzyl-8-[(3S)-3-benzylpiperazin-1-yl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-benzyl-8-[(3S)-3-benzylpiperazin-1-yl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 58890734 |
| Molecular Formula | C25H28N6O2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 7-benzyl-8-[(3S)-3-benzylpiperazin-1-yl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(N3CCN[C@@H](Cc4ccccc4)C3)n2Cc2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C25H28N6O2/c1-28-22-21(23(32)29(2)25(28)33)31(16-19-11-7-4-8-12-19)24(27-22)30-14-13-26-20(17-30)15-18-9-5-3-6-10-18/h3-12,20,26H,13-17H2,1-2H3/t20-/m0/s1 |
| InChIKey | ANTRLZZSHHSNLE-FQEVSTJZSA-N |
| XLogP | 1.50 |
| TPSA | 77.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |