About N-(3-chlorophenyl)-4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]naphthalene-1-sulfonamide
N-(3-chlorophenyl)-4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]naphthalene-1-sulfonamide (PubChem CID 10162035) has the molecular formula C22H24ClN3O2S
and a molecular weight of 429.97 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]naphthalene-1-sulfonamide.
Molecular Properties
| Compound Name | N-(3-chlorophenyl)-4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]naphthalene-1-sulfonamide |
| PubChem CID | 10162035 |
| Molecular Formula | C22H24ClN3O2S |
| Molecular Weight | 429.97 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | N-(3-chlorophenyl)-4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]naphthalene-1-sulfonamide |
| SMILES | C[C@@H]1CN(c2ccc(S(=O)(=O)Nc3cccc(Cl)c3)c3ccccc23)C[C@H](C)N1 |
| InChI | InChI=1S/C22H24ClN3O2S/c1-15-13-26(14-16(2)24-15)21-10-11-22(20-9-4-3-8-19(20)21)29(27,28)25-18-7-5-6-17(23)12-18/h3-12,15-16,24-25H,13-14H2,1-2H3/t15-,16+ |
| InChIKey | ZAMNPQKOUMEFLT-IYBDPMFKSA-N |
| XLogP | 4.48 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.97 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-chlorophenyl)-4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]naphthalene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chlorophenyl)-4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]naphthalene-1-sulfonamide?
The IUPAC name of N-(3-chlorophenyl)-4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]naphthalene-1-sulfonamide (CID 10162035) is N-(3-chlorophenyl)-4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]naphthalene-1-sulfonamide.
What is the SMILES notation for N-(3-chlorophenyl)-4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]naphthalene-1-sulfonamide?
The canonical SMILES for N-(3-chlorophenyl)-4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]naphthalene-1-sulfonamide is C[C@@H]1CN(c2ccc(S(=O)(=O)Nc3cccc(Cl)c3)c3ccccc23)C[C@H](C)N1.
What is the InChIKey of N-(3-chlorophenyl)-4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]naphthalene-1-sulfonamide?
The InChIKey is ZAMNPQKOUMEFLT-IYBDPMFKSA-N. The full InChI is InChI=1S/C22H24ClN3O2S/c1-15-13-26(14-16(2)24-15)21-10-11-22(20-9-4-3-8-19(20)21)29(27,28)25-18-7-5-6-17(23)12-18/h3-12,15-16,24-25H,13-14H2,1-2H3/t15-,16+.
What are the key properties of N-(3-chlorophenyl)-4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]naphthalene-1-sulfonamide?
N-(3-chlorophenyl)-4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]naphthalene-1-sulfonamide has a molecular weight of 429.97 g/mol, XLogP of 4.48, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chlorophenyl)-4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]naphthalene-1-sulfonamide is sourced from PubChem (CID 10162035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).