C28H39N7O — CID 10163398
5-[(E)-but-1-enyl]-2-octyl-4-[[4-[2-(tetrazolidin-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-one (PubChem CID 10163398) has the molecular formula C28H39N7O and a molecular weight of 489.67 g/mol. Its IUPAC name is 5-[(E)-but-1-enyl]-2-octyl-4-[[4-[2-(tetrazolidin-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-one.
| Compound Name | 5-[(E)-but-1-enyl]-2-octyl-4-[[4-[2-(tetrazolidin-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 10163398 |
| Molecular Formula | C28H39N7O |
| Molecular Weight | 489.67 g/mol |
| Exact Mass | 489.32 |
| IUPAC Name | 5-[(E)-but-1-enyl]-2-octyl-4-[[4-[2-(tetrazolidin-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-one |
| SMILES | CC/C=C/c1nn(CCCCCCCC)c(=O)n1Cc1ccc(-c2ccccc2C2NNNN2)cc1 |
| InChI | InChI=1S/C28H39N7O/c1-3-5-7-8-9-12-20-35-28(36)34(26(31-35)15-6-4-2)21-22-16-18-23(19-17-22)24-13-10-11-14-25(24)27-29-32-33-30-27/h6,10-11,13-19,27,29-30,32-33H,3-5,7-9,12,20-21H2,1-2H3/b15-6+ |
| InChIKey | XZLVXFXLIMQTSD-GIDUJCDVSA-N |
| XLogP | 4.66 |
| TPSA | 87.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.67 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|