C25H29N3O6S2 — CID 10165430
2-[methyl(thiophen-2-ylmethyl)amino]ethyl 2-methyl-4-(3-nitrophenyl)-5,5-dioxo-1,4,6,7,8,9-hexahydrothiepino[3,2-b]pyridine-3-carboxylate (PubChem CID 10165430) has the molecular formula C25H29N3O6S2 and a molecular weight of 531.66 g/mol. Its IUPAC name is 2-[methyl(thiophen-2-ylmethyl)amino]ethyl 2-methyl-4-(3-nitrophenyl)-5,5-dioxo-1,4,6,7,8,9-hexahydrothiepino[3,2-b]pyridine-3-carboxylate.
| Compound Name | 2-[methyl(thiophen-2-ylmethyl)amino]ethyl 2-methyl-4-(3-nitrophenyl)-5,5-dioxo-1,4,6,7,8,9-hexahydrothiepino[3,2-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 10165430 |
| Molecular Formula | C25H29N3O6S2 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | 2-[methyl(thiophen-2-ylmethyl)amino]ethyl 2-methyl-4-(3-nitrophenyl)-5,5-dioxo-1,4,6,7,8,9-hexahydrothiepino[3,2-b]pyridine-3-carboxylate |
| SMILES | CC1=C(C(=O)OCCN(C)Cc2cccs2)C(c2cccc([N+](=O)[O-])c2)C2=C(CCCCS2(=O)=O)N1 |
| InChI | InChI=1S/C25H29N3O6S2/c1-17-22(25(29)34-12-11-27(2)16-20-9-6-13-35-20)23(18-7-5-8-19(15-18)28(30)31)24-21(26-17)10-3-4-14-36(24,32)33/h5-9,13,15,23,26H,3-4,10-12,14,16H2,1-2H3 |
| InChIKey | UHKQEPPPFKNUSO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|