C29H28Cl2N2O4S2 — CID 10282264
2-[methyl(thiophen-2-ylmethyl)amino]ethyl 4-(2,3-dichlorophenyl)-2-methyl-5,5-dioxo-1,4,6,7-tetrahydro-[3]benzothiepino[5,4-b]pyridine-3-carboxylate (PubChem CID 10282264) has the molecular formula C29H28Cl2N2O4S2 and a molecular weight of 603.59 g/mol. Its IUPAC name is 2-[methyl(thiophen-2-ylmethyl)amino]ethyl 4-(2,3-dichlorophenyl)-2-methyl-5,5-dioxo-1,4,6,7-tetrahydro-[3]benzothiepino[5,4-b]pyridine-3-carboxylate.
| Compound Name | 2-[methyl(thiophen-2-ylmethyl)amino]ethyl 4-(2,3-dichlorophenyl)-2-methyl-5,5-dioxo-1,4,6,7-tetrahydro-[3]benzothiepino[5,4-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 10282264 |
| Molecular Formula | C29H28Cl2N2O4S2 |
| Molecular Weight | 603.59 g/mol |
| Exact Mass | 602.09 |
| IUPAC Name | 2-[methyl(thiophen-2-ylmethyl)amino]ethyl 4-(2,3-dichlorophenyl)-2-methyl-5,5-dioxo-1,4,6,7-tetrahydro-[3]benzothiepino[5,4-b]pyridine-3-carboxylate |
| SMILES | CC1=C(C(=O)OCCN(C)Cc2cccs2)C(c2cccc(Cl)c2Cl)C2=C(N1)c1ccccc1CCS2(=O)=O |
| InChI | InChI=1S/C29H28Cl2N2O4S2/c1-18-24(29(34)37-14-13-33(2)17-20-8-6-15-38-20)25(22-10-5-11-23(30)26(22)31)28-27(32-18)21-9-4-3-7-19(21)12-16-39(28,35)36/h3-11,15,25,32H,12-14,16-17H2,1-2H3 |
| InChIKey | AQXGKRIJLLSUIF-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.59 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |