C34H43N5O — CID 10165683
1-methyl-4-[8-[2-[3-methyl-5-(4-phenylphenyl)-1,2,4-triazol-4-yl]phenoxy]octyl]piperazine (PubChem CID 10165683) has the molecular formula C34H43N5O and a molecular weight of 537.75 g/mol. Its IUPAC name is 1-methyl-4-[8-[2-[3-methyl-5-(4-phenylphenyl)-1,2,4-triazol-4-yl]phenoxy]octyl]piperazine.
| Compound Name | 1-methyl-4-[8-[2-[3-methyl-5-(4-phenylphenyl)-1,2,4-triazol-4-yl]phenoxy]octyl]piperazine |
|---|---|
| PubChem CID | 10165683 |
| Molecular Formula | C34H43N5O |
| Molecular Weight | 537.75 g/mol |
| Exact Mass | 537.35 |
| IUPAC Name | 1-methyl-4-[8-[2-[3-methyl-5-(4-phenylphenyl)-1,2,4-triazol-4-yl]phenoxy]octyl]piperazine |
| SMILES | Cc1nnc(-c2ccc(-c3ccccc3)cc2)n1-c1ccccc1OCCCCCCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C34H43N5O/c1-28-35-36-34(31-20-18-30(19-21-31)29-14-8-7-9-15-29)39(28)32-16-10-11-17-33(32)40-27-13-6-4-3-5-12-22-38-25-23-37(2)24-26-38/h7-11,14-21H,3-6,12-13,22-27H2,1-2H3 |
| InChIKey | LDNWUKVFPZRPRN-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.75 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|