C32H40N4O — CID 166626055
3-[4-[5-butyl-1-[4-(4-methylphenyl)phenyl]-1,2,4-triazol-3-yl]phenoxy]-N,N-diethylpropan-1-amine (PubChem CID 166626055) has the molecular formula C32H40N4O and a molecular weight of 496.70 g/mol. Its IUPAC name is 3-[4-[5-butyl-1-[4-(4-methylphenyl)phenyl]-1,2,4-triazol-3-yl]phenoxy]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[4-[5-butyl-1-[4-(4-methylphenyl)phenyl]-1,2,4-triazol-3-yl]phenoxy]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 166626055 |
| Molecular Formula | C32H40N4O |
| Molecular Weight | 496.70 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | 3-[4-[5-butyl-1-[4-(4-methylphenyl)phenyl]-1,2,4-triazol-3-yl]phenoxy]-N,N-diethylpropan-1-amine |
| SMILES | CCCCc1nc(-c2ccc(OCCCN(CC)CC)cc2)nn1-c1ccc(-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C32H40N4O/c1-5-8-10-31-33-32(28-17-21-30(22-18-28)37-24-9-23-35(6-2)7-3)34-36(31)29-19-15-27(16-20-29)26-13-11-25(4)12-14-26/h11-22H,5-10,23-24H2,1-4H3 |
| InChIKey | HCGIKFAWJLNUAZ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.70 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|