C22H19N3O — CID 798454
4-(4-ethoxyphenyl)-3,5-diphenyl-1,2,4-triazole (PubChem CID 798454) has the molecular formula C22H19N3O and a molecular weight of 341.41 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)-3,5-diphenyl-1,2,4-triazole.
| Compound Name | 4-(4-ethoxyphenyl)-3,5-diphenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 798454 |
| Molecular Formula | C22H19N3O |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 4-(4-ethoxyphenyl)-3,5-diphenyl-1,2,4-triazole |
| SMILES | CCOc1ccc(-n2c(-c3ccccc3)nnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19N3O/c1-2-26-20-15-13-19(14-16-20)25-21(17-9-5-3-6-10-17)23-24-22(25)18-11-7-4-8-12-18/h3-16H,2H2,1H3 |
| InChIKey | CICAOVOSYCHEBU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |