C29H38N6O — CID 166632549
3-[4-[5-butyl-1-[4-(2-methylpyrazol-3-yl)phenyl]-1,2,4-triazol-3-yl]phenoxy]-N,N-diethylpropan-1-amine (PubChem CID 166632549) has the molecular formula C29H38N6O and a molecular weight of 486.66 g/mol. Its IUPAC name is 3-[4-[5-butyl-1-[4-(2-methylpyrazol-3-yl)phenyl]-1,2,4-triazol-3-yl]phenoxy]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[4-[5-butyl-1-[4-(2-methylpyrazol-3-yl)phenyl]-1,2,4-triazol-3-yl]phenoxy]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 166632549 |
| Molecular Formula | C29H38N6O |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.31 |
| IUPAC Name | 3-[4-[5-butyl-1-[4-(2-methylpyrazol-3-yl)phenyl]-1,2,4-triazol-3-yl]phenoxy]-N,N-diethylpropan-1-amine |
| SMILES | CCCCc1nc(-c2ccc(OCCCN(CC)CC)cc2)nn1-c1ccc(-c2ccnn2C)cc1 |
| InChI | InChI=1S/C29H38N6O/c1-5-8-10-28-31-29(24-13-17-26(18-14-24)36-22-9-21-34(6-2)7-3)32-35(28)25-15-11-23(12-16-25)27-19-20-30-33(27)4/h11-20H,5-10,21-22H2,1-4H3 |
| InChIKey | JWJAAGLQNAUPLK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 61.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|