C34H42N4O3 — CID 166625795
ethyl 4-[4-[5-butyl-3-[4-[3-(diethylamino)propoxy]phenyl]-1,2,4-triazol-1-yl]phenyl]benzoate (PubChem CID 166625795) has the molecular formula C34H42N4O3 and a molecular weight of 554.74 g/mol. Its IUPAC name is ethyl 4-[4-[5-butyl-3-[4-[3-(diethylamino)propoxy]phenyl]-1,2,4-triazol-1-yl]phenyl]benzoate.
| Compound Name | ethyl 4-[4-[5-butyl-3-[4-[3-(diethylamino)propoxy]phenyl]-1,2,4-triazol-1-yl]phenyl]benzoate |
|---|---|
| PubChem CID | 166625795 |
| Molecular Formula | C34H42N4O3 |
| Molecular Weight | 554.74 g/mol |
| Exact Mass | 554.33 |
| IUPAC Name | ethyl 4-[4-[5-butyl-3-[4-[3-(diethylamino)propoxy]phenyl]-1,2,4-triazol-1-yl]phenyl]benzoate |
| SMILES | CCCCc1nc(-c2ccc(OCCCN(CC)CC)cc2)nn1-c1ccc(-c2ccc(C(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C34H42N4O3/c1-5-9-11-32-35-33(28-18-22-31(23-19-28)41-25-10-24-37(6-2)7-3)36-38(32)30-20-16-27(17-21-30)26-12-14-29(15-13-26)34(39)40-8-4/h12-23H,5-11,24-25H2,1-4H3 |
| InChIKey | UBKLWDWKJSJUBZ-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.74 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|