C31H38N4O2 — CID 166631239
3-[4-[5-butyl-1-(4-phenoxyphenyl)-1,2,4-triazol-3-yl]phenoxy]-N,N-diethylpropan-1-amine (PubChem CID 166631239) has the molecular formula C31H38N4O2 and a molecular weight of 498.67 g/mol. Its IUPAC name is 3-[4-[5-butyl-1-(4-phenoxyphenyl)-1,2,4-triazol-3-yl]phenoxy]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[4-[5-butyl-1-(4-phenoxyphenyl)-1,2,4-triazol-3-yl]phenoxy]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 166631239 |
| Molecular Formula | C31H38N4O2 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | 3-[4-[5-butyl-1-(4-phenoxyphenyl)-1,2,4-triazol-3-yl]phenoxy]-N,N-diethylpropan-1-amine |
| SMILES | CCCCc1nc(-c2ccc(OCCCN(CC)CC)cc2)nn1-c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C31H38N4O2/c1-4-7-14-30-32-31(25-15-19-27(20-16-25)36-24-11-23-34(5-2)6-3)33-35(30)26-17-21-29(22-18-26)37-28-12-9-8-10-13-28/h8-10,12-13,15-22H,4-7,11,14,23-24H2,1-3H3 |
| InChIKey | DFNIAVHTBRRSIE-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|