C30H36N6O7 — CID 10167436
tert-butyl (3R,4E)-4-(carbamoylhydrazinylidene)-3-[[(2S,11S)-12-oxo-11-(phenylmethoxycarbonylamino)-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carbonyl]amino]butanoate (PubChem CID 10167436) has the molecular formula C30H36N6O7 and a molecular weight of 592.65 g/mol. Its IUPAC name is tert-butyl (3R,4E)-4-(carbamoylhydrazinylidene)-3-[[(2S,11S)-12-oxo-11-(phenylmethoxycarbonylamino)-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carbonyl]amino]butanoate.
| Compound Name | tert-butyl (3R,4E)-4-(carbamoylhydrazinylidene)-3-[[(2S,11S)-12-oxo-11-(phenylmethoxycarbonylamino)-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 10167436 |
| Molecular Formula | C30H36N6O7 |
| Molecular Weight | 592.65 g/mol |
| Exact Mass | 592.26 |
| IUPAC Name | tert-butyl (3R,4E)-4-(carbamoylhydrazinylidene)-3-[[(2S,11S)-12-oxo-11-(phenylmethoxycarbonylamino)-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-carbonyl]amino]butanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](/C=N/NC(N)=O)NC(=O)[C@@H]1Cc2cccc3c2N1C(=O)[C@@H](NC(=O)OCc1ccccc1)CC3 |
| InChI | InChI=1S/C30H36N6O7/c1-30(2,3)43-24(37)15-21(16-32-35-28(31)40)33-26(38)23-14-20-11-7-10-19-12-13-22(27(39)36(23)25(19)20)34-29(41)42-17-18-8-5-4-6-9-18/h4-11,16,21-23H,12-15,17H2,1-3H3,(H,33,38)(H,34,41)(H3,31,35,40)/b32-16+/t21-,22+,23+/m1/s1 |
| InChIKey | UDQPQSYIKPHPHO-VRJNVMMKSA-N |
| XLogP | 2.06 |
| TPSA | 181.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.65 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|