C23H31BrN4O5 — CID 166747931
tert-butyl N-[(2S,11S)-2-[(5-amino-5-oxopentan-2-yl)carbamoyl]-6-bromo-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-11-yl]carbamate (PubChem CID 166747931) has the molecular formula C23H31BrN4O5 and a molecular weight of 523.43 g/mol. Its IUPAC name is tert-butyl N-[(2S,11S)-2-[(5-amino-5-oxopentan-2-yl)carbamoyl]-6-bromo-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-11-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,11S)-2-[(5-amino-5-oxopentan-2-yl)carbamoyl]-6-bromo-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-11-yl]carbamate |
|---|---|
| PubChem CID | 166747931 |
| Molecular Formula | C23H31BrN4O5 |
| Molecular Weight | 523.43 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | tert-butyl N-[(2S,11S)-2-[(5-amino-5-oxopentan-2-yl)carbamoyl]-6-bromo-12-oxo-1-azatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-11-yl]carbamate |
| SMILES | CC(CCC(N)=O)NC(=O)[C@@H]1Cc2cc(Br)cc3c2N1C(=O)[C@@H](NC(=O)OC(C)(C)C)CC3 |
| InChI | InChI=1S/C23H31BrN4O5/c1-12(5-8-18(25)29)26-20(30)17-11-14-10-15(24)9-13-6-7-16(21(31)28(17)19(13)14)27-22(32)33-23(2,3)4/h9-10,12,16-17H,5-8,11H2,1-4H3,(H2,25,29)(H,26,30)(H,27,32)/t12?,16-,17-/m0/s1 |
| InChIKey | LLQUASNGUWTUIU-XZNKJRRYSA-N |
| XLogP | 2.32 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |