C28H36N6O7 — CID 142168049
(4E)-4-(carbamoylhydrazinylidene)-3-[[7-methyl-1-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]-2,3-dihydroindole-2-carbonyl]amino]butanoic acid;ethane (PubChem CID 142168049) has the molecular formula C28H36N6O7 and a molecular weight of 568.63 g/mol. Its IUPAC name is (4E)-4-(carbamoylhydrazinylidene)-3-[[7-methyl-1-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]-2,3-dihydroindole-2-carbonyl]amino]butanoic acid;ethane.
| Compound Name | (4E)-4-(carbamoylhydrazinylidene)-3-[[7-methyl-1-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]-2,3-dihydroindole-2-carbonyl]amino]butanoic acid;ethane |
|---|---|
| PubChem CID | 142168049 |
| Molecular Formula | C28H36N6O7 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | (4E)-4-(carbamoylhydrazinylidene)-3-[[7-methyl-1-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]-2,3-dihydroindole-2-carbonyl]amino]butanoic acid;ethane |
| SMILES | CC.Cc1cccc2c1N(C(=O)[C@H](C)NC(=O)OCc1ccccc1)C(C(=O)NC(/C=N/NC(N)=O)CC(=O)O)C2 |
| InChI | InChI=1S/C26H30N6O7.C2H6/c1-15-7-6-10-18-11-20(23(35)30-19(12-21(33)34)13-28-31-25(27)37)32(22(15)18)24(36)16(2)29-26(38)39-14-17-8-4-3-5-9-17;1-2/h3-10,13,16,19-20H,11-12,14H2,1-2H3,(H,29,38)(H,30,35)(H,33,34)(H3,27,31,37);1-2H3/b28-13+;/t16-,19?,20?;/m0./s1 |
| InChIKey | NYUTYKCSZTYFSA-MTSQOQCVSA-N |
| XLogP | 2.21 |
| TPSA | 192.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|