C21H28N6O6 — CID 142168060
(4E)-3-[[1-[(2S)-2-acetamidopropanoyl]-7-ethyl-2,3-dihydroindole-2-carbonyl]amino]-4-(carbamoylhydrazinylidene)butanoic acid (PubChem CID 142168060) has the molecular formula C21H28N6O6 and a molecular weight of 460.49 g/mol. Its IUPAC name is (4E)-3-[[1-[(2S)-2-acetamidopropanoyl]-7-ethyl-2,3-dihydroindole-2-carbonyl]amino]-4-(carbamoylhydrazinylidene)butanoic acid.
| Compound Name | (4E)-3-[[1-[(2S)-2-acetamidopropanoyl]-7-ethyl-2,3-dihydroindole-2-carbonyl]amino]-4-(carbamoylhydrazinylidene)butanoic acid |
|---|---|
| PubChem CID | 142168060 |
| Molecular Formula | C21H28N6O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | (4E)-3-[[1-[(2S)-2-acetamidopropanoyl]-7-ethyl-2,3-dihydroindole-2-carbonyl]amino]-4-(carbamoylhydrazinylidene)butanoic acid |
| SMILES | CCc1cccc2c1N(C(=O)[C@H](C)NC(C)=O)C(C(=O)NC(/C=N/NC(N)=O)CC(=O)O)C2 |
| InChI | InChI=1S/C21H28N6O6/c1-4-13-6-5-7-14-8-16(27(18(13)14)20(32)11(2)24-12(3)28)19(31)25-15(9-17(29)30)10-23-26-21(22)33/h5-7,10-11,15-16H,4,8-9H2,1-3H3,(H,24,28)(H,25,31)(H,29,30)(H3,22,26,33)/b23-10+/t11-,15?,16?/m0/s1 |
| InChIKey | FFMUHHZULFRSQV-FDTORUKNSA-N |
| XLogP | -0.36 |
| TPSA | 183.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|