C29H33N3O5 — CID 142168065
N-[(2R)-4,4-dihydroxybutan-2-yl]-7-ethyl-1-[2-(naphthalene-1-carbonylamino)propanoyl]-2,3-dihydroindole-2-carboxamide (PubChem CID 142168065) has the molecular formula C29H33N3O5 and a molecular weight of 503.60 g/mol. Its IUPAC name is N-[(2R)-4,4-dihydroxybutan-2-yl]-7-ethyl-1-[2-(naphthalene-1-carbonylamino)propanoyl]-2,3-dihydroindole-2-carboxamide.
| Compound Name | N-[(2R)-4,4-dihydroxybutan-2-yl]-7-ethyl-1-[2-(naphthalene-1-carbonylamino)propanoyl]-2,3-dihydroindole-2-carboxamide |
|---|---|
| PubChem CID | 142168065 |
| Molecular Formula | C29H33N3O5 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | N-[(2R)-4,4-dihydroxybutan-2-yl]-7-ethyl-1-[2-(naphthalene-1-carbonylamino)propanoyl]-2,3-dihydroindole-2-carboxamide |
| SMILES | CCc1cccc2c1N(C(=O)C(C)NC(=O)c1cccc3ccccc13)C(C(=O)N[C@H](C)CC(O)O)C2 |
| InChI | InChI=1S/C29H33N3O5/c1-4-19-10-7-12-21-16-24(28(36)30-17(2)15-25(33)34)32(26(19)21)29(37)18(3)31-27(35)23-14-8-11-20-9-5-6-13-22(20)23/h5-14,17-18,24-25,33-34H,4,15-16H2,1-3H3,(H,30,36)(H,31,35)/t17-,18?,24?/m1/s1 |
| InChIKey | CMTVKNSUKGSFGQ-MDPMHESRSA-N |
| XLogP | 2.68 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|