C24H25ClN4O6 — CID 59043771
(3S)-3-[[(3S)-2-[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 59043771) has the molecular formula C24H25ClN4O6 and a molecular weight of 500.94 g/mol. Its IUPAC name is (3S)-3-[[(3S)-2-[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[(3S)-2-[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59043771 |
| Molecular Formula | C24H25ClN4O6 |
| Molecular Weight | 500.94 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | (3S)-3-[[(3S)-2-[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | C[C@H](NC(=O)c1ccc(N)c(Cl)c1)C(=O)N1Cc2ccccc2C[C@H]1C(=O)N[C@H](C=O)CC(=O)O |
| InChI | InChI=1S/C24H25ClN4O6/c1-13(27-22(33)15-6-7-19(26)18(25)8-15)24(35)29-11-16-5-3-2-4-14(16)9-20(29)23(34)28-17(12-30)10-21(31)32/h2-8,12-13,17,20H,9-11,26H2,1H3,(H,27,33)(H,28,34)(H,31,32)/t13-,17-,20-/m0/s1 |
| InChIKey | IWQPFJHNTDVIMU-ROOHIHILSA-N |
| XLogP | 1.15 |
| TPSA | 158.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.94 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|