C42H34N2O4 — CID 10168185
2,5-bis(phenylmethoxy)-3,6-bis(2-prop-2-enyl-1H-indol-3-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 10168185) has the molecular formula C42H34N2O4 and a molecular weight of 630.74 g/mol. Its IUPAC name is 2,5-bis(phenylmethoxy)-3,6-bis(2-prop-2-enyl-1H-indol-3-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis(phenylmethoxy)-3,6-bis(2-prop-2-enyl-1H-indol-3-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 10168185 |
| Molecular Formula | C42H34N2O4 |
| Molecular Weight | 630.74 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | 2,5-bis(phenylmethoxy)-3,6-bis(2-prop-2-enyl-1H-indol-3-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | C=CCc1[nH]c2ccccc2c1C1=C(OCc2ccccc2)C(=O)C(c2c(CC=C)[nH]c3ccccc23)=C(OCc2ccccc2)C1=O |
| InChI | InChI=1S/C42H34N2O4/c1-3-15-33-35(29-21-11-13-23-31(29)43-33)37-39(45)42(48-26-28-19-9-6-10-20-28)38(40(46)41(37)47-25-27-17-7-5-8-18-27)36-30-22-12-14-24-32(30)44-34(36)16-4-2/h3-14,17-24,43-44H,1-2,15-16,25-26H2 |
| InChIKey | AWHOVMLBTPVBHT-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.74 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|