C29H26N2O4 — CID 163052948
2-(1H-indol-3-yl)-3,6-dimethoxy-5-[2-(3-methylbut-2-enyl)-1H-indol-3-yl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 163052948) has the molecular formula C29H26N2O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-3,6-dimethoxy-5-[2-(3-methylbut-2-enyl)-1H-indol-3-yl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(1H-indol-3-yl)-3,6-dimethoxy-5-[2-(3-methylbut-2-enyl)-1H-indol-3-yl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 163052948 |
| Molecular Formula | C29H26N2O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 2-(1H-indol-3-yl)-3,6-dimethoxy-5-[2-(3-methylbut-2-enyl)-1H-indol-3-yl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(c2c[nH]c3ccccc23)C(=O)C(OC)=C(c2c(CC=C(C)C)[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C29H26N2O4/c1-16(2)13-14-22-23(18-10-6-8-12-21(18)31-22)25-27(33)28(34-3)24(26(32)29(25)35-4)19-15-30-20-11-7-5-9-17(19)20/h5-13,15,30-31H,14H2,1-4H3 |
| InChIKey | LGEPKSYEXWTAFR-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|