C34H34N2O4 — CID 70130053
2,5-dihydroxy-3,6-bis[2-(4-methylpent-3-enyl)-1H-indol-3-yl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 70130053) has the molecular formula C34H34N2O4 and a molecular weight of 534.66 g/mol. Its IUPAC name is 2,5-dihydroxy-3,6-bis[2-(4-methylpent-3-enyl)-1H-indol-3-yl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-dihydroxy-3,6-bis[2-(4-methylpent-3-enyl)-1H-indol-3-yl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 70130053 |
| Molecular Formula | C34H34N2O4 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | 2,5-dihydroxy-3,6-bis[2-(4-methylpent-3-enyl)-1H-indol-3-yl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(C)=CCCc1[nH]c2ccccc2c1C1=C(O)C(=O)C(c2c(CCC=C(C)C)[nH]c3ccccc23)=C(O)C1=O |
| InChI | InChI=1S/C34H34N2O4/c1-19(2)11-9-17-25-27(21-13-5-7-15-23(21)35-25)29-31(37)33(39)30(34(40)32(29)38)28-22-14-6-8-16-24(22)36-26(28)18-10-12-20(3)4/h5-8,11-16,35-37,40H,9-10,17-18H2,1-4H3 |
| InChIKey | SADPLGVYBIBGFP-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|