C18H25N3O3 — CID 10172067
6-(3-ethyl-4-methylanilino)-3-(5-hydroxypentyl)-1H-pyrimidine-2,4-dione (PubChem CID 10172067) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 6-(3-ethyl-4-methylanilino)-3-(5-hydroxypentyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(3-ethyl-4-methylanilino)-3-(5-hydroxypentyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10172067 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 6-(3-ethyl-4-methylanilino)-3-(5-hydroxypentyl)-1H-pyrimidine-2,4-dione |
| SMILES | CCc1cc(Nc2cc(=O)n(CCCCCO)c(=O)[nH]2)ccc1C |
| InChI | InChI=1S/C18H25N3O3/c1-3-14-11-15(8-7-13(14)2)19-16-12-17(23)21(18(24)20-16)9-5-4-6-10-22/h7-8,11-12,19,22H,3-6,9-10H2,1-2H3,(H,20,24) |
| InChIKey | XVXBDBZBXLUWGE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|