C23H27NO6 — CID 10173181
methyl (2Z,3E,5E,7E,9Z)-2-ethylidene-11-[(5E)-5-(2-methoxy-2-oxoethylidene)-2-oxopyrrolidin-3-yl]-4,10-dimethyl-11-oxoundeca-3,5,7,9-tetraenoate (PubChem CID 10173181) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is methyl (2Z,3E,5E,7E,9Z)-2-ethylidene-11-[(5E)-5-(2-methoxy-2-oxoethylidene)-2-oxopyrrolidin-3-yl]-4,10-dimethyl-11-oxoundeca-3,5,7,9-tetraenoate.
| Compound Name | methyl (2Z,3E,5E,7E,9Z)-2-ethylidene-11-[(5E)-5-(2-methoxy-2-oxoethylidene)-2-oxopyrrolidin-3-yl]-4,10-dimethyl-11-oxoundeca-3,5,7,9-tetraenoate |
|---|---|
| PubChem CID | 10173181 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | methyl (2Z,3E,5E,7E,9Z)-2-ethylidene-11-[(5E)-5-(2-methoxy-2-oxoethylidene)-2-oxopyrrolidin-3-yl]-4,10-dimethyl-11-oxoundeca-3,5,7,9-tetraenoate |
| SMILES | C/C=C(/C=C(C)/C=C/C=C/C=C(/C)C(=O)C1C/C(=C\C(=O)OC)NC1=O)C(=O)OC |
| InChI | InChI=1S/C23H27NO6/c1-6-17(23(28)30-5)12-15(2)10-8-7-9-11-16(3)21(26)19-13-18(24-22(19)27)14-20(25)29-4/h6-12,14,19H,13H2,1-5H3,(H,24,27)/b9-7+,10-8+,15-12+,16-11-,17-6-,18-14+ |
| InChIKey | AOKMHMDDNNTCPH-VQKHMSAFSA-N |
| XLogP | 2.87 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|