C23H31NO9 — CID 177480768
methyl (2E,3E,5R,6S,7E,9E)-11-[(3aS,6R,6aR)-3a,6-dihydroxy-5-oxo-2,3,4,6a-tetrahydrofuro[3,2-b]pyrrol-6-yl]-2-ethylidene-5,6-dihydroxy-4,6,10-trimethyl-11-oxoundeca-3,7,9-trienoate (PubChem CID 177480768) has the molecular formula C23H31NO9 and a molecular weight of 465.50 g/mol. Its IUPAC name is methyl (2E,3E,5R,6S,7E,9E)-11-[(3aS,6R,6aR)-3a,6-dihydroxy-5-oxo-2,3,4,6a-tetrahydrofuro[3,2-b]pyrrol-6-yl]-2-ethylidene-5,6-dihydroxy-4,6,10-trimethyl-11-oxoundeca-3,7,9-trienoate.
| Compound Name | methyl (2E,3E,5R,6S,7E,9E)-11-[(3aS,6R,6aR)-3a,6-dihydroxy-5-oxo-2,3,4,6a-tetrahydrofuro[3,2-b]pyrrol-6-yl]-2-ethylidene-5,6-dihydroxy-4,6,10-trimethyl-11-oxoundeca-3,7,9-trienoate |
|---|---|
| PubChem CID | 177480768 |
| Molecular Formula | C23H31NO9 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | methyl (2E,3E,5R,6S,7E,9E)-11-[(3aS,6R,6aR)-3a,6-dihydroxy-5-oxo-2,3,4,6a-tetrahydrofuro[3,2-b]pyrrol-6-yl]-2-ethylidene-5,6-dihydroxy-4,6,10-trimethyl-11-oxoundeca-3,7,9-trienoate |
| SMILES | C/C=C(\C=C(/C)[C@@H](O)[C@@](C)(O)/C=C/C=C(\C)C(=O)[C@@]1(O)C(=O)N[C@]2(O)CCO[C@H]12)C(=O)OC |
| InChI | InChI=1S/C23H31NO9/c1-6-15(18(27)32-5)12-14(3)16(25)21(4,29)9-7-8-13(2)17(26)23(31)19-22(30,10-11-33-19)24-20(23)28/h6-9,12,16,19,25,29-31H,10-11H2,1-5H3,(H,24,28)/b9-7+,13-8+,14-12+,15-6+/t16-,19+,21+,22+,23+/m1/s1 |
| InChIKey | FMSCBQFTEBBTMH-ZSTVRAHCSA-N |
| XLogP | -0.43 |
| TPSA | 162.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|