C9H12F2O4 — CID 129074012
methyl (E,2E)-5-(difluoromethoxy)-2-ethylidene-4-hydroxypent-3-enoate (PubChem CID 129074012) has the molecular formula C9H12F2O4 and a molecular weight of 222.19 g/mol. Its IUPAC name is methyl (E,2E)-5-(difluoromethoxy)-2-ethylidene-4-hydroxypent-3-enoate.
| Compound Name | methyl (E,2E)-5-(difluoromethoxy)-2-ethylidene-4-hydroxypent-3-enoate |
|---|---|
| PubChem CID | 129074012 |
| Molecular Formula | C9H12F2O4 |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | methyl (E,2E)-5-(difluoromethoxy)-2-ethylidene-4-hydroxypent-3-enoate |
| SMILES | C/C=C(\C=C(\O)COC(F)F)C(=O)OC |
| InChI | InChI=1S/C9H12F2O4/c1-3-6(8(13)14-2)4-7(12)5-15-9(10)11/h3-4,9,12H,5H2,1-2H3/b6-3+,7-4+ |
| InChIKey | WDCMRLJDDOWJRW-XOKGJFMYSA-N |
| XLogP | 1.79 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|