About copper;bis((3-hydroxy-4-methoxy-4-oxobut-2-enoyl)azanium)
copper;bis((3-hydroxy-4-methoxy-4-oxobut-2-enoyl)azanium) (PubChem CID 135964358) has the molecular formula C10H16CuN2O8+2
and a molecular weight of 355.79 g/mol. Its IUPAC name is copper;bis((3-hydroxy-4-methoxy-4-oxobut-2-enoyl)azanium).
Molecular Properties
| Compound Name | copper;bis((3-hydroxy-4-methoxy-4-oxobut-2-enoyl)azanium) |
| PubChem CID | 135964358 |
| Molecular Formula | C10H16CuN2O8+2 |
| Molecular Weight | 355.79 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | copper;bis((3-hydroxy-4-methoxy-4-oxobut-2-enoyl)azanium) |
| SMILES | COC(=O)C(O)=CC([NH3+])=O.COC(=O)C(O)=CC([NH3+])=O.[Cu] |
| InChI | InChI=1S/2C5H7NO4.Cu/c2*1-10-5(9)3(7)2-4(6)8;/h2*2,7H,1H3,(H2,6,8);/p+2 |
| InChIKey | NLRFNXIOYOOAJP-UHFFFAOYSA-P |
| XLogP | -3.26 |
| TPSA | 182.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.79 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze copper;bis((3-hydroxy-4-methoxy-4-oxobut-2-enoyl)azanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;bis((3-hydroxy-4-methoxy-4-oxobut-2-enoyl)azanium)?
The IUPAC name of copper;bis((3-hydroxy-4-methoxy-4-oxobut-2-enoyl)azanium) (CID 135964358) is copper;bis((3-hydroxy-4-methoxy-4-oxobut-2-enoyl)azanium).
What is the SMILES notation for copper;bis((3-hydroxy-4-methoxy-4-oxobut-2-enoyl)azanium)?
The canonical SMILES for copper;bis((3-hydroxy-4-methoxy-4-oxobut-2-enoyl)azanium) is COC(=O)C(O)=CC([NH3+])=O.COC(=O)C(O)=CC([NH3+])=O.[Cu].
What is the InChIKey of copper;bis((3-hydroxy-4-methoxy-4-oxobut-2-enoyl)azanium)?
The InChIKey is NLRFNXIOYOOAJP-UHFFFAOYSA-P. The full InChI is InChI=1S/2C5H7NO4.Cu/c2*1-10-5(9)3(7)2-4(6)8;/h2*2,7H,1H3,(H2,6,8);/p+2.
What are the key properties of copper;bis((3-hydroxy-4-methoxy-4-oxobut-2-enoyl)azanium)?
copper;bis((3-hydroxy-4-methoxy-4-oxobut-2-enoyl)azanium) has a molecular weight of 355.79 g/mol, XLogP of -3.26, 4 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for copper;bis((3-hydroxy-4-methoxy-4-oxobut-2-enoyl)azanium) is sourced from PubChem (CID 135964358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).