C44H59NO5Si2 — CID 11468271
methyl (2E,3E,5E,7E,9E,12E,14S)-16-[tert-butyl(diphenyl)silyl]oxy-12-cyano-2-ethylidene-4,10-dimethyl-11-oxo-14-triethylsilyloxyhexadeca-3,5,7,9,12-pentaenoate (PubChem CID 11468271) has the molecular formula C44H59NO5Si2 and a molecular weight of 738.13 g/mol. Its IUPAC name is methyl (2E,3E,5E,7E,9E,12E,14S)-16-[tert-butyl(diphenyl)silyl]oxy-12-cyano-2-ethylidene-4,10-dimethyl-11-oxo-14-triethylsilyloxyhexadeca-3,5,7,9,12-pentaenoate.
| Compound Name | methyl (2E,3E,5E,7E,9E,12E,14S)-16-[tert-butyl(diphenyl)silyl]oxy-12-cyano-2-ethylidene-4,10-dimethyl-11-oxo-14-triethylsilyloxyhexadeca-3,5,7,9,12-pentaenoate |
|---|---|
| PubChem CID | 11468271 |
| Molecular Formula | C44H59NO5Si2 |
| Molecular Weight | 738.13 g/mol |
| Exact Mass | 737.39 |
| IUPAC Name | methyl (2E,3E,5E,7E,9E,12E,14S)-16-[tert-butyl(diphenyl)silyl]oxy-12-cyano-2-ethylidene-4,10-dimethyl-11-oxo-14-triethylsilyloxyhexadeca-3,5,7,9,12-pentaenoate |
| SMILES | C/C=C(\C=C(C)\C=C\C=C\C=C(/C)C(=O)/C(C#N)=C/[C@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](CC)(CC)CC)C(=O)OC |
| InChI | InChI=1S/C44H59NO5Si2/c1-11-37(43(47)48-10)32-35(5)24-18-15-19-25-36(6)42(46)38(34-45)33-39(50-51(12-2,13-3)14-4)30-31-49-52(44(7,8)9,40-26-20-16-21-27-40)41-28-22-17-23-29-41/h11,15-29,32-33,39H,12-14,30-31H2,1-10H3/b19-15+,24-18+,35-32+,36-25+,37-11+,38-33+/t39-/m0/s1 |
| InChIKey | UYPGUUCZNHRICM-GQYKYWNJSA-N |
| XLogP | 9.49 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.13 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|