C18H21NO3 — CID 11483406
methyl (2E,3E,5E,7E,9E)-12-cyano-2-ethylidene-4,10-dimethyl-11-oxododeca-3,5,7,9-tetraenoate (PubChem CID 11483406) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is methyl (2E,3E,5E,7E,9E)-12-cyano-2-ethylidene-4,10-dimethyl-11-oxododeca-3,5,7,9-tetraenoate.
| Compound Name | methyl (2E,3E,5E,7E,9E)-12-cyano-2-ethylidene-4,10-dimethyl-11-oxododeca-3,5,7,9-tetraenoate |
|---|---|
| PubChem CID | 11483406 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | methyl (2E,3E,5E,7E,9E)-12-cyano-2-ethylidene-4,10-dimethyl-11-oxododeca-3,5,7,9-tetraenoate |
| SMILES | C/C=C(\C=C(C)\C=C\C=C\C=C(/C)C(=O)CC#N)C(=O)OC |
| InChI | InChI=1S/C18H21NO3/c1-5-16(18(21)22-4)13-14(2)9-7-6-8-10-15(3)17(20)11-12-19/h5-10,13H,11H2,1-4H3/b8-6+,9-7+,14-13+,15-10+,16-5+ |
| InChIKey | CLDBUIPXDVDTOL-ZMUMFWGVSA-N |
| XLogP | 3.59 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|