C25H25Cl2N3O — CID 10173794
N-[3,4-bis(4-chlorophenyl)butan-2-yl]-1,2,3,4-tetrahydro-1,8-naphthyridine-2-carboxamide (PubChem CID 10173794) has the molecular formula C25H25Cl2N3O and a molecular weight of 454.40 g/mol. Its IUPAC name is N-[3,4-bis(4-chlorophenyl)butan-2-yl]-1,2,3,4-tetrahydro-1,8-naphthyridine-2-carboxamide.
| Compound Name | N-[3,4-bis(4-chlorophenyl)butan-2-yl]-1,2,3,4-tetrahydro-1,8-naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 10173794 |
| Molecular Formula | C25H25Cl2N3O |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | N-[3,4-bis(4-chlorophenyl)butan-2-yl]-1,2,3,4-tetrahydro-1,8-naphthyridine-2-carboxamide |
| SMILES | CC(NC(=O)C1CCc2cccnc2N1)C(Cc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H25Cl2N3O/c1-16(29-25(31)23-13-8-19-3-2-14-28-24(19)30-23)22(18-6-11-21(27)12-7-18)15-17-4-9-20(26)10-5-17/h2-7,9-12,14,16,22-23H,8,13,15H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | QYCFAQYEQBGPDH-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |