C26H32N6O2 — CID 10173902
1-[(1R,2S)-2-[[(3S)-3-benzyl-5-oxopiperazin-1-yl]methyl]cyclohexyl]-3-(1H-indazol-5-yl)urea (PubChem CID 10173902) has the molecular formula C26H32N6O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 1-[(1R,2S)-2-[[(3S)-3-benzyl-5-oxopiperazin-1-yl]methyl]cyclohexyl]-3-(1H-indazol-5-yl)urea.
| Compound Name | 1-[(1R,2S)-2-[[(3S)-3-benzyl-5-oxopiperazin-1-yl]methyl]cyclohexyl]-3-(1H-indazol-5-yl)urea |
|---|---|
| PubChem CID | 10173902 |
| Molecular Formula | C26H32N6O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 1-[(1R,2S)-2-[[(3S)-3-benzyl-5-oxopiperazin-1-yl]methyl]cyclohexyl]-3-(1H-indazol-5-yl)urea |
| SMILES | O=C1CN(C[C@@H]2CCCC[C@H]2NC(=O)Nc2ccc3[nH]ncc3c2)C[C@H](Cc2ccccc2)N1 |
| InChI | InChI=1S/C26H32N6O2/c33-25-17-32(16-22(28-25)12-18-6-2-1-3-7-18)15-19-8-4-5-9-23(19)30-26(34)29-21-10-11-24-20(13-21)14-27-31-24/h1-3,6-7,10-11,13-14,19,22-23H,4-5,8-9,12,15-17H2,(H,27,31)(H,28,33)(H2,29,30,34)/t19-,22-,23+/m0/s1 |
| InChIKey | RFNBDYYQJDUEOY-AJSBUHFISA-N |
| XLogP | 3.29 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |