C30H31ClN4O4 — CID 10174975
4-[(6-chloro-1-benzofuran-4-yl)amino]-5-(oxan-2-yloxy)-7-(3-pyrrolidin-1-ylpropoxy)quinoline-3-carbonitrile (PubChem CID 10174975) has the molecular formula C30H31ClN4O4 and a molecular weight of 547.06 g/mol. Its IUPAC name is 4-[(6-chloro-1-benzofuran-4-yl)amino]-5-(oxan-2-yloxy)-7-(3-pyrrolidin-1-ylpropoxy)quinoline-3-carbonitrile.
| Compound Name | 4-[(6-chloro-1-benzofuran-4-yl)amino]-5-(oxan-2-yloxy)-7-(3-pyrrolidin-1-ylpropoxy)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 10174975 |
| Molecular Formula | C30H31ClN4O4 |
| Molecular Weight | 547.06 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | 4-[(6-chloro-1-benzofuran-4-yl)amino]-5-(oxan-2-yloxy)-7-(3-pyrrolidin-1-ylpropoxy)quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2cc(OCCCN3CCCC3)cc(OC3CCCCO3)c2c1Nc1cc(Cl)cc2occc12 |
| InChI | InChI=1S/C30H31ClN4O4/c31-21-14-24(23-7-13-37-26(23)15-21)34-30-20(18-32)19-33-25-16-22(36-12-5-10-35-8-2-3-9-35)17-27(29(25)30)39-28-6-1-4-11-38-28/h7,13-17,19,28H,1-6,8-12H2,(H,33,34) |
| InChIKey | GEKIWRNQZFQMHS-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.06 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|