C32H33F2N5O2 — CID 10175068
3-[1-[3-(4-fluoro-2-methoxyphenoxy)propyl]piperidin-4-yl]-1-(4-fluorophenyl)-5-(3-methyltriazol-4-yl)indole (PubChem CID 10175068) has the molecular formula C32H33F2N5O2 and a molecular weight of 557.65 g/mol. Its IUPAC name is 3-[1-[3-(4-fluoro-2-methoxyphenoxy)propyl]piperidin-4-yl]-1-(4-fluorophenyl)-5-(3-methyltriazol-4-yl)indole.
| Compound Name | 3-[1-[3-(4-fluoro-2-methoxyphenoxy)propyl]piperidin-4-yl]-1-(4-fluorophenyl)-5-(3-methyltriazol-4-yl)indole |
|---|---|
| PubChem CID | 10175068 |
| Molecular Formula | C32H33F2N5O2 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | 3-[1-[3-(4-fluoro-2-methoxyphenoxy)propyl]piperidin-4-yl]-1-(4-fluorophenyl)-5-(3-methyltriazol-4-yl)indole |
| SMILES | COc1cc(F)ccc1OCCCN1CCC(c2cn(-c3ccc(F)cc3)c3ccc(-c4cnnn4C)cc23)CC1 |
| InChI | InChI=1S/C32H33F2N5O2/c1-37-30(20-35-36-37)23-4-10-29-27(18-23)28(21-39(29)26-8-5-24(33)6-9-26)22-12-15-38(16-13-22)14-3-17-41-31-11-7-25(34)19-32(31)40-2/h4-11,18-22H,3,12-17H2,1-2H3 |
| InChIKey | QUYGVVBKXGUMHL-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 57.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|