C9H14O2 — CID 10176228
(5E,7E)-4-hydroxynona-5,7-dien-2-one (PubChem CID 10176228) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (5E,7E)-4-hydroxynona-5,7-dien-2-one.
| Compound Name | (5E,7E)-4-hydroxynona-5,7-dien-2-one |
|---|---|
| PubChem CID | 10176228 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (5E,7E)-4-hydroxynona-5,7-dien-2-one |
| SMILES | C/C=C/C=C/C(O)CC(C)=O |
| InChI | InChI=1S/C9H14O2/c1-3-4-5-6-9(11)7-8(2)10/h3-6,9,11H,7H2,1-2H3/b4-3+,6-5+ |
| InChIKey | GJJWWGQYXYPBSB-VNKDHWASSA-N |
| XLogP | 1.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|