C7H13N5O3 — CID 10176748
(2S)-1-(2-hydrazinyl-2-oxoacetyl)pyrrolidine-2-carbohydrazide (PubChem CID 10176748) has the molecular formula C7H13N5O3 and a molecular weight of 215.21 g/mol. Its IUPAC name is (2S)-1-(2-hydrazinyl-2-oxoacetyl)pyrrolidine-2-carbohydrazide.
| Compound Name | (2S)-1-(2-hydrazinyl-2-oxoacetyl)pyrrolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 10176748 |
| Molecular Formula | C7H13N5O3 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | (2S)-1-(2-hydrazinyl-2-oxoacetyl)pyrrolidine-2-carbohydrazide |
| SMILES | NNC(=O)C(=O)N1CCC[C@H]1C(=O)NN |
| InChI | InChI=1S/C7H13N5O3/c8-10-5(13)4-2-1-3-12(4)7(15)6(14)11-9/h4H,1-3,8-9H2,(H,10,13)(H,11,14)/t4-/m0/s1 |
| InChIKey | PEKFEHZPMCCCII-BYPYZUCNSA-N |
| XLogP | -3.04 |
| TPSA | 130.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|