C22H26FN5O — CID 10178823
N-(2-fluoroethyl)-2-[3-(1H-indazol-5-ylamino)piperidin-1-yl]-2-phenylacetamide (PubChem CID 10178823) has the molecular formula C22H26FN5O and a molecular weight of 395.48 g/mol. Its IUPAC name is N-(2-fluoroethyl)-2-[3-(1H-indazol-5-ylamino)piperidin-1-yl]-2-phenylacetamide.
| Compound Name | N-(2-fluoroethyl)-2-[3-(1H-indazol-5-ylamino)piperidin-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 10178823 |
| Molecular Formula | C22H26FN5O |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | N-(2-fluoroethyl)-2-[3-(1H-indazol-5-ylamino)piperidin-1-yl]-2-phenylacetamide |
| SMILES | O=C(NCCF)C(c1ccccc1)N1CCCC(Nc2ccc3[nH]ncc3c2)C1 |
| InChI | InChI=1S/C22H26FN5O/c23-10-11-24-22(29)21(16-5-2-1-3-6-16)28-12-4-7-19(15-28)26-18-8-9-20-17(13-18)14-25-27-20/h1-3,5-6,8-9,13-14,19,21,26H,4,7,10-12,15H2,(H,24,29)(H,25,27) |
| InChIKey | YPKYQWFYIHNKDX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |