C29H32N4O3 — CID 66716183
2-[5-[[3-(1H-indazol-5-ylamino)piperidin-1-yl]methyl]-2-methylphenoxy]ethyl benzoate (PubChem CID 66716183) has the molecular formula C29H32N4O3 and a molecular weight of 484.60 g/mol. Its IUPAC name is 2-[5-[[3-(1H-indazol-5-ylamino)piperidin-1-yl]methyl]-2-methylphenoxy]ethyl benzoate.
| Compound Name | 2-[5-[[3-(1H-indazol-5-ylamino)piperidin-1-yl]methyl]-2-methylphenoxy]ethyl benzoate |
|---|---|
| PubChem CID | 66716183 |
| Molecular Formula | C29H32N4O3 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 2-[5-[[3-(1H-indazol-5-ylamino)piperidin-1-yl]methyl]-2-methylphenoxy]ethyl benzoate |
| SMILES | Cc1ccc(CN2CCCC(Nc3ccc4[nH]ncc4c3)C2)cc1OCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H32N4O3/c1-21-9-10-22(16-28(21)35-14-15-36-29(34)23-6-3-2-4-7-23)19-33-13-5-8-26(20-33)31-25-11-12-27-24(17-25)18-30-32-27/h2-4,6-7,9-12,16-18,26,31H,5,8,13-15,19-20H2,1H3,(H,30,32) |
| InChIKey | VHWOFNDURJPLMZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|