C22H17ClN4OS — CID 10180477
N-(4-chlorophenyl)-2-(pyridin-4-ylmethylamino)-5-thiophen-3-ylpyridine-3-carboxamide (PubChem CID 10180477) has the molecular formula C22H17ClN4OS and a molecular weight of 420.93 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(pyridin-4-ylmethylamino)-5-thiophen-3-ylpyridine-3-carboxamide.
| Compound Name | N-(4-chlorophenyl)-2-(pyridin-4-ylmethylamino)-5-thiophen-3-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 10180477 |
| Molecular Formula | C22H17ClN4OS |
| Molecular Weight | 420.93 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | N-(4-chlorophenyl)-2-(pyridin-4-ylmethylamino)-5-thiophen-3-ylpyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1cc(-c2ccsc2)cnc1NCc1ccncc1 |
| InChI | InChI=1S/C22H17ClN4OS/c23-18-1-3-19(4-2-18)27-22(28)20-11-17(16-7-10-29-14-16)13-26-21(20)25-12-15-5-8-24-9-6-15/h1-11,13-14H,12H2,(H,25,26)(H,27,28) |
| InChIKey | XTJAAKUOFNPJKZ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.93 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |