C18H20N4O9 — CID 10181460
3-[[1-[(3,4-dimethoxyphenyl)methyl]-5-nitro-2-oxopyridine-3-carbonyl]amino]propyl nitrate (PubChem CID 10181460) has the molecular formula C18H20N4O9 and a molecular weight of 436.38 g/mol. Its IUPAC name is 3-[[1-[(3,4-dimethoxyphenyl)methyl]-5-nitro-2-oxopyridine-3-carbonyl]amino]propyl nitrate.
| Compound Name | 3-[[1-[(3,4-dimethoxyphenyl)methyl]-5-nitro-2-oxopyridine-3-carbonyl]amino]propyl nitrate |
|---|---|
| PubChem CID | 10181460 |
| Molecular Formula | C18H20N4O9 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 3-[[1-[(3,4-dimethoxyphenyl)methyl]-5-nitro-2-oxopyridine-3-carbonyl]amino]propyl nitrate |
| SMILES | COc1ccc(Cn2cc([N+](=O)[O-])cc(C(=O)NCCCO[N+](=O)[O-])c2=O)cc1OC |
| InChI | InChI=1S/C18H20N4O9/c1-29-15-5-4-12(8-16(15)30-2)10-20-11-13(21(25)26)9-14(18(20)24)17(23)19-6-3-7-31-22(27)28/h4-5,8-9,11H,3,6-7,10H2,1-2H3,(H,19,23) |
| InChIKey | MIJUBUKBGKGOCD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 165.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|