C19H21N5O12 — CID 10185908
2-[[1-[(3,4-dimethoxyphenyl)methyl]-5-nitro-2-oxopyridine-3-carbonyl]-(2-nitrooxyethyl)amino]ethyl nitrate (PubChem CID 10185908) has the molecular formula C19H21N5O12 and a molecular weight of 511.40 g/mol. Its IUPAC name is 2-[[1-[(3,4-dimethoxyphenyl)methyl]-5-nitro-2-oxopyridine-3-carbonyl]-(2-nitrooxyethyl)amino]ethyl nitrate.
| Compound Name | 2-[[1-[(3,4-dimethoxyphenyl)methyl]-5-nitro-2-oxopyridine-3-carbonyl]-(2-nitrooxyethyl)amino]ethyl nitrate |
|---|---|
| PubChem CID | 10185908 |
| Molecular Formula | C19H21N5O12 |
| Molecular Weight | 511.40 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | 2-[[1-[(3,4-dimethoxyphenyl)methyl]-5-nitro-2-oxopyridine-3-carbonyl]-(2-nitrooxyethyl)amino]ethyl nitrate |
| SMILES | COc1ccc(Cn2cc([N+](=O)[O-])cc(C(=O)N(CCO[N+](=O)[O-])CCO[N+](=O)[O-])c2=O)cc1OC |
| InChI | InChI=1S/C19H21N5O12/c1-33-16-4-3-13(9-17(16)34-2)11-21-12-14(22(27)28)10-15(19(21)26)18(25)20(5-7-35-23(29)30)6-8-36-24(31)32/h3-4,9-10,12H,5-8,11H2,1-2H3 |
| InChIKey | DSWVBEGBXZMKDC-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 208.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.40 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|