C21H24N2O5S2 — CID 10182286
[3-(1-methylpiperidin-4-yl)-1-methylsulfonylindol-5-yl] benzenesulfonate (PubChem CID 10182286) has the molecular formula C21H24N2O5S2 and a molecular weight of 448.57 g/mol. Its IUPAC name is [3-(1-methylpiperidin-4-yl)-1-methylsulfonylindol-5-yl] benzenesulfonate.
| Compound Name | [3-(1-methylpiperidin-4-yl)-1-methylsulfonylindol-5-yl] benzenesulfonate |
|---|---|
| PubChem CID | 10182286 |
| Molecular Formula | C21H24N2O5S2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | [3-(1-methylpiperidin-4-yl)-1-methylsulfonylindol-5-yl] benzenesulfonate |
| SMILES | CN1CCC(c2cn(S(C)(=O)=O)c3ccc(OS(=O)(=O)c4ccccc4)cc23)CC1 |
| InChI | InChI=1S/C21H24N2O5S2/c1-22-12-10-16(11-13-22)20-15-23(29(2,24)25)21-9-8-17(14-19(20)21)28-30(26,27)18-6-4-3-5-7-18/h3-9,14-16H,10-13H2,1-2H3 |
| InChIKey | AZHRYUWDBDETMB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|